Difference between revisions of "CPD-157"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOBUTANOL == * common-name: ** isobutanol * smiles: ** cc(c)co * inchi-key: ** zxekiibdnhejcq-uhfffaoysa-n * molecular-weight: ** 74.122...") |
(Created page with "Category:metabolite == Metabolite CPD-157 == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles: ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o * inchi-k...") |
||
(2 intermediate revisions by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-157 == |
* common-name: | * common-name: | ||
− | ** | + | ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate |
* smiles: | * smiles: | ||
− | ** cc(c) | + | ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** rfenovfrmprrji-ydcwotkksa-l |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 212.159 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[MHPCHYDROL-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=212.159}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-157
- common-name:
- (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
- smiles:
- c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
- inchi-key:
- rfenovfrmprrji-ydcwotkksa-l
- molecular-weight:
- 212.159