|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RIB5PISOM-RXN RIB5PISOM-RXN] == | + | == Metabolite CPD-157 == |
| − | * direction:
| |
| − | ** reversible
| |
| | * common-name: | | * common-name: |
| − | ** ribose-5-phosphate isomerase | + | ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/5.3.1.6 ec-5.3.1.6] | + | ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o |
| − | == Reaction formula == | + | * inchi-key: |
| − | * 1 [[RIBOSE-5P]][c] '''<=>''' 1 [[RIBULOSE-5P]][c]
| + | ** rfenovfrmprrji-ydcwotkksa-l |
| − | == Gene(s) associated with this reaction ==
| + | * molecular-weight: |
| − | * Gene: [[SJ00411]] | + | ** 212.159 |
| − | ** Category: [[annotation]]
| + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[MHPCHYDROL-RXN]] |
| − | ** Category: [[orthology]]
| + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | == Reaction(s) of unknown directionality == |
| − | * Gene: [[SJ07743]]
| + | {{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}} |
| − | ** Category: [[annotation]]
| + | {{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}} |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | {{#set: molecular-weight=212.159}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | *** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[P124-PWY]], Bifidobacterium shunt: [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY] | |
| − | ** '''12''' reactions found over '''15''' reactions in the full pathway
| |
| − | * [[P185-PWY]], formaldehyde assimilation III (dihydroxyacetone cycle): [http://metacyc.org/META/NEW-IMAGE?object=P185-PWY P185-PWY]
| |
| − | ** '''11''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[NONOXIPENT-PWY]], pentose phosphate pathway (non-oxidative branch): [http://metacyc.org/META/NEW-IMAGE?object=NONOXIPENT-PWY NONOXIPENT-PWY]
| |
| − | ** '''5''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5723]], Rubisco shunt: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5723 PWY-5723]
| |
| − | ** '''10''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[CALVIN-PWY]], Calvin-Benson-Bassham cycle: [http://metacyc.org/META/NEW-IMAGE?object=CALVIN-PWY CALVIN-PWY]
| |
| − | ** '''12''' reactions found over '''13''' reactions in the full pathway
| |
| − | * [[PWY-1861]], formaldehyde assimilation II (assimilatory RuMP Cycle): [http://metacyc.org/META/NEW-IMAGE?object=PWY-1861 PWY-1861]
| |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | == External links == | |
| − | * RHEA:
| |
| − | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14660 14660]
| |
| − | * LIGAND-RXN:
| |
| − | ** [http://www.genome.jp/dbget-bin/www_bget?R01056 R01056]
| |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P0A7Z0 P0A7Z0]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CDI7 Q9CDI7]
| |
| − | ** [http://www.uniprot.org/uniprot/P44725 P44725]
| |
| − | ** [http://www.uniprot.org/uniprot/Q58998 Q58998]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JTM5 Q9JTM5]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PP08 Q9PP08]
| |
| − | ** [http://www.uniprot.org/uniprot/P37351 P37351]
| |
| − | ** [http://www.uniprot.org/uniprot/P74234 P74234]
| |
| − | ** [http://www.uniprot.org/uniprot/Q55766 Q55766]
| |
| − | {{#set: direction=reversible}}
| |
| − | {{#set: common-name=ribose-5-phosphate isomerase}} | |
| − | {{#set: ec-number=ec-5.3.1.6}}
| |
| − | {{#set: nb gene associated=2}} | |
| − | {{#set: nb pathway associated=6}}
| |
| − | {{#set: reconstruction category=orthology|annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools|pantograph}} | |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_arabidopsis_thaliana|output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
