Difference between revisions of "CPD-157"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15588 RXN-15588] == * direction: ** reversible * common-name: ** 4-methylphenol sulfotransferas...")
(Created page with "Category:metabolite == Metabolite CPD-157 == * common-name: ** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate * smiles: ** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o * inchi-k...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15588 RXN-15588] ==
+
== Metabolite CPD-157 ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 4-methylphenol sulfotransferase
+
** (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
−
** aryl sulfotransferase
+
* smiles:
−
* ec-number:
+
** c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
−
** [http://enzyme.expasy.org/EC/2.8.2.1 ec-2.8.2.1]
+
* inchi-key:
−
== Reaction formula ==
+
** rfenovfrmprrji-ydcwotkksa-l
−
* 1 [[CPD-108]][c] '''+''' 1 [[PAPS]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[CPD-16819]][c] '''+''' 1 [[PROTON]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 212.159
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ06276]]
+
* [[MHPCHYDROL-RXN]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ19194]]
+
{{#set: common-name=(2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=rfenovfrmprrji-ydcwotkksa-l}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=212.159}}
−
* Gene: [[SJ10094]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
* Gene: [[SJ07550]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ01900]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ05841]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ00192]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=4-methylphenol sulfotransferase|aryl sulfotransferase}}
 
−
{{#set: ec-number=ec-2.8.2.1}}
 
−
{{#set: nb gene associated=7}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-157

  • common-name:
    • (2z,4e)-2-hydroxy-6-oxonona-2,4-diene-1,9-dioate
  • smiles:
    • c([o-])(=o)ccc(=o)c=cc=c(c([o-])=o)o
  • inchi-key:
    • rfenovfrmprrji-ydcwotkksa-l
  • molecular-weight:
    • 212.159

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-157&oldid=139258"