Difference between revisions of "CPD-15709"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8091 == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop...")
(Created page with "Category:metabolite == Metabolite CPD-471 == * common-name: ** (r)-3-amino-2-methylpropanoate * smiles: ** cc(c[n+])c([o-])=o * inchi-key: ** qchpksfmdhpsnr-gsvougtgsa-n *...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8091 ==
+
== Metabolite CPD-471 ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-linoleoyl-phosphatidylcholine
+
** (r)-3-amino-2-methylpropanoate
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** cc(c[n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** gdwulugdxghjij-vjhnmzkjsa-n
+
** qchpksfmdhpsnr-gsvougtgsa-n
 
* molecular-weight:
 
* molecular-weight:
** 784.107
+
** 103.121
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8322]]
 
* [[RXN-8326]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8327]]
+
* [[RXN-11210]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=(r)-3-amino-2-methylpropanoate}}
{{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}}
+
{{#set: inchi-key=inchikey=qchpksfmdhpsnr-gsvougtgsa-n}}
{{#set: molecular-weight=784.107}}
+
{{#set: molecular-weight=103.121}}

Revision as of 08:28, 15 March 2021

Metabolite CPD-471

  • common-name:
    • (r)-3-amino-2-methylpropanoate
  • smiles:
    • cc(c[n+])c([o-])=o
  • inchi-key:
    • qchpksfmdhpsnr-gsvougtgsa-n
  • molecular-weight:
    • 103.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality