Difference between revisions of "CPD-15709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite CPD-15709 == * common-name: ** keto-d-fructose 6-phosphate == Reaction(s) known to consume the compound == * RXN-14812 == Reaction(s)...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-15709 == |
* common-name: | * common-name: | ||
− | ** | + | ** keto-d-fructose 6-phosphate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-14812]] | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-14812]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=keto-d-fructose 6-phosphate}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-15709
- common-name:
- keto-d-fructose 6-phosphate