|
|
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ04188 == | + | == Metabolite PHE == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** l-phenylalanine |
| − | * right-end-position: | + | * smiles: |
| − | ** 12972 | + | ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 7855 | + | ** colnvldhvkwlrt-qmmmgpobsa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 7.1134896 | + | ** 165.191 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[2.6.1.64-RXN]] |
| − | == Reaction(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[2.6.1.57-RXN]] | |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[ASPAMINOTRANS-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[HISTAMINOTRANS-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| | * [[PHEAMINOTRANS-RXN]] | | * [[PHEAMINOTRANS-RXN]] |
| − | ** Category: [[annotation]] | + | * [[PHENYLALANINE--TRNA-LIGASE-RXN]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| | * [[RXN-10814]] | | * [[RXN-10814]] |
| − | ** Category: [[annotation]]
| + | * [[RXN-17130]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | * [[biomass_rxn]] |
| − | * [[RXN-11737]] | + | == Reaction(s) known to produce the compound == |
| − | ** Category: [[annotation]] | + | * [[2.6.1.64-RXN]] |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | * [[PHEAMINOTRANS-RXN]] |
| − | * [[RXN-13697]]
| + | * [[RXN-10814]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: common-name=l-phenylalanine}} |
| − | * [[RXN-14147]]
| + | {{#set: inchi-key=inchikey=colnvldhvkwlrt-qmmmgpobsa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=165.191}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | * [[TYROSINE-AMINOTRANSFERASE-RXN]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[ASPARAGINE-DEG1-PWY-1]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[ASPARTATESYN-PWY]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[GLUTDEG-PWY]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5913]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-7383]]
| |
| − | ** '''4''' reactions found over '''7''' reactions in the full pathway
| |
| − | * [[PWY-7117]]
| |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-7115]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[ASPARTATE-DEG1-PWY]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[MALATE-ASPARTATE-SHUTTLE-PWY]]
| |
| − | ** '''2''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[HISTSYN-PWY]]
| |
| − | ** '''10''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[ANAPHENOXI-PWY]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PHESYN]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7432]]
| |
| − | ** '''3''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5079]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-6318]]
| |
| − | ** '''4''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-6638]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6642]]
| |
| − | ** '''2''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-6643]]
| |
| − | ** '''1''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-5081]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[TRPKYNCAT-PWY]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[TRPIAACAT-PWY]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-581]]
| |
| − | ** '''5''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-3581]]
| |
| − | ** '''6''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY3O-4108]]
| |
| − | ** '''2''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-5048]]
| |
| − | ** '''1''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[TYRFUMCAT-PWY]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7514]]
| |
| − | ** '''1''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5886]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7518]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[TYRSYN]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-5754]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-5151]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=12972}} | |
| − | {{#set: left-end-position=7855}}
| |
| − | {{#set: centisome-position=7.1134896 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=10}}
| |
| − | {{#set: nb pathway associated=32}}
| |
