Difference between revisions of "CPD-15709"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite PHE == * common-name: ** l-phenylalanine * smiles: ** c([o-])(=o)c([n+])cc1(c=cc=cc=1) * inchi-key: ** colnvldhvkwlrt-qmmmgpobsa-n * mole...") |
(Created page with "Category:metabolite == Metabolite Cellodextrins == * common-name: ** a cellodextrin == Reaction(s) known to consume the compound == * 3.2.1.91-RXN == Reaction(s) known...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Cellodextrins == |
* common-name: | * common-name: | ||
| − | ** | + | ** a cellodextrin |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[2 | + | * [[3.2.1.91-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-2043]] | |
| − | |||
| − | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a cellodextrin}} |
| − | |||
| − | |||
Revision as of 14:57, 5 January 2021
Contents
Metabolite Cellodextrins
- common-name:
- a cellodextrin
