Difference between revisions of "CPD-15709"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Cellodextrins == * common-name: ** a cellodextrin == Reaction(s) known to consume the compound == * 3.2.1.91-RXN == Reaction(s) known...")
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate * smiles: ** cc(=cccc(=c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Cellodextrins ==
+
== Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE ==
 
* common-name:
 
* common-name:
** a cellodextrin
+
** 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
 +
* smiles:
 +
** cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
 +
* inchi-key:
 +
** yszsvgfmajxgmq-fricuitqsa-m
 +
* molecular-weight:
 +
** 575.85
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[3.2.1.91-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-2043]]
+
* [[2.1.1.114-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a cellodextrin}}
+
{{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate}}
 +
{{#set: inchi-key=inchikey=yszsvgfmajxgmq-fricuitqsa-m}}
 +
{{#set: molecular-weight=575.85}}

Revision as of 15:27, 5 January 2021

Metabolite 3-HEXAPRENYL-4-HYDROXY-5-METHOXYBENZOATE

  • common-name:
    • 3-methoxy-4-hydroxy-5-all-trans-hexaprenylbenzoate
  • smiles:
    • cc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c
  • inchi-key:
    • yszsvgfmajxgmq-fricuitqsa-m
  • molecular-weight:
    • 575.85

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality