Difference between revisions of "CPD-15834"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17263 == * common-name: ** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)scc...")
(Created page with "Category:metabolite == Metabolite FADH2 == * common-name: ** fadh2 * smiles: ** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17263 ==
+
== Metabolite FADH2 ==
 
* common-name:
 
* common-name:
** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa
+
** fadh2
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
 
* inchi-key:
 
* inchi-key:
** pcgphlmaazkqfq-fpxdaddusa-j
+
** ypzrhbjkemoyqh-uybvjogssa-l
 
* molecular-weight:
 
* molecular-weight:
** 1065.958
+
** 785.556
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16021]]
+
* [[ACOAD1f]]
 +
* [[PPCOAOm]]
 +
* [[RXN-14264]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16020]]
+
* [[ACOA120OR]]
 +
* [[ACOA140OR]]
 +
* [[ACOA160OR]]
 +
* [[ACOA40OR]]
 +
* [[ACOA80OR]]
 +
* [[ACOAD1f]]
 +
* [[IVCDH]]
 +
* [[MCDH]]
 +
* [[MCDH_LPAREN_2mb2coa_RPAREN_]]
 +
* [[PPCOAOm]]
 +
* [[RXN-14264]]
 +
* [[SUCDHm]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa}}
+
{{#set: common-name=fadh2}}
{{#set: inchi-key=inchikey=pcgphlmaazkqfq-fpxdaddusa-j}}
+
{{#set: inchi-key=inchikey=ypzrhbjkemoyqh-uybvjogssa-l}}
{{#set: molecular-weight=1065.958}}
+
{{#set: molecular-weight=785.556}}

Revision as of 11:13, 15 January 2021

Metabolite FADH2

  • common-name:
    • fadh2
  • smiles:
    • cc1(=c(c)c=c2(n(c3(nc(nc(=o)c(nc(=c1)2)=3)=o))cc(o)c(o)c(o)cop(op([o-])(occ6(c(o)c(o)c(n5(c=nc4(c(n)=nc=nc=45)))o6))=o)([o-])=o))
  • inchi-key:
    • ypzrhbjkemoyqh-uybvjogssa-l
  • molecular-weight:
    • 785.556

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality