Difference between revisions of "CPD-15913"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03683 == * transcription-direction: ** negative * right-end-position: ** 101460 * left-end-position: ** 84110 * centisome-position: ** 71.145805...") |
(Created page with "Category:metabolite == Metabolite CPD-15913 == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o) * inchi-key: **...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-15913 == |
| − | * | + | * common-name: |
| − | ** | + | ** aurachin c epoxide |
| − | * | + | * smiles: |
| − | ** | + | ** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o) |
| − | * | + | * inchi-key: |
| − | ** | + | ** forhhprbeftlrm-yefhwucqsa-n |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 395.541 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-15029]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=aurachin c epoxide}} | |
| − | + | {{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}} | |
| − | + | {{#set: molecular-weight=395.541}} | |
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-15913
- common-name:
- aurachin c epoxide
- smiles:
- cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
- inchi-key:
- forhhprbeftlrm-yefhwucqsa-n
- molecular-weight:
- 395.541
