Difference between revisions of "CPD-15913"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14392 == * common-name: ** stearidonoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite CPD-15913 == * common-name: ** aurachin c epoxide * smiles: ** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o) * inchi-key: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-14392 ==
+
== Metabolite CPD-15913 ==
 
* common-name:
 
* common-name:
** stearidonoyl-coa
+
** aurachin c epoxide
 
* smiles:
 
* smiles:
** ccc=ccc=ccc=ccc=cccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
 
* inchi-key:
 
* inchi-key:
** ddhcsalwdprvcn-uswkvxsksa-j
+
** forhhprbeftlrm-yefhwucqsa-n
 
* molecular-weight:
 
* molecular-weight:
** 1021.905
+
** 395.541
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-13426]]
+
* [[RXN-15029]]
* [[RXN-16041]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=stearidonoyl-coa}}
+
{{#set: common-name=aurachin c epoxide}}
{{#set: inchi-key=inchikey=ddhcsalwdprvcn-uswkvxsksa-j}}
+
{{#set: inchi-key=inchikey=forhhprbeftlrm-yefhwucqsa-n}}
{{#set: molecular-weight=1021.905}}
+
{{#set: molecular-weight=395.541}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-15913

  • common-name:
    • aurachin c epoxide
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=ccc12(oc(c)1n(c3(c=cc=cc(c2=o)=3))o)
  • inchi-key:
    • forhhprbeftlrm-yefhwucqsa-n
  • molecular-weight:
    • 395.541

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality