Difference between revisions of "CPD-15977"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7206 == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c * inchi-key:...")
(Created page with "Category:metabolite == Metabolite 56-Dihydrouracil16-in-tRNAs == * common-name: ** a 5,6-dihydrouracil16 in trna == Reaction(s) known to consume the compound == == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7206 ==
+
== Metabolite 56-Dihydrouracil16-in-tRNAs ==
 
* common-name:
 
* common-name:
** 8'-apo-β-carotenal
+
** a 5,6-dihydrouracil16 in trna
* smiles:
 
** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c
 
* inchi-key:
 
** dfmmvlfmmaqxhz-dokbywhisa-n
 
* molecular-weight:
 
** 416.645
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11783]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-12454]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8'-apo-β-carotenal}}
+
{{#set: common-name=a 5,6-dihydrouracil16 in trna}}
{{#set: inchi-key=inchikey=dfmmvlfmmaqxhz-dokbywhisa-n}}
 
{{#set: molecular-weight=416.645}}
 

Revision as of 08:24, 15 March 2021

Metabolite 56-Dihydrouracil16-in-tRNAs

  • common-name:
    • a 5,6-dihydrouracil16 in trna

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality