Difference between revisions of "CPD-15977"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7206 == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c * inchi-key:...")
(Created page with "Category:metabolite == Metabolite CPD-15977 == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o * inchi-key: ** a...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-7206 ==
+
== Metabolite CPD-15977 ==
 
* common-name:
 
* common-name:
** 8'-apo-β-carotenal
+
** 1,2-dioleoylglycerol
 
* smiles:
 
* smiles:
** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c
+
** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o
 
* inchi-key:
 
* inchi-key:
** dfmmvlfmmaqxhz-dokbywhisa-n
+
** afshuzfnmvjnkx-llwmboqksa-n
 
* molecular-weight:
 
* molecular-weight:
** 416.645
+
** 620.995
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-11783]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-15090]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=8'-apo-β-carotenal}}
+
{{#set: common-name=1,2-dioleoylglycerol}}
{{#set: inchi-key=inchikey=dfmmvlfmmaqxhz-dokbywhisa-n}}
+
{{#set: inchi-key=inchikey=afshuzfnmvjnkx-llwmboqksa-n}}
{{#set: molecular-weight=416.645}}
+
{{#set: molecular-weight=620.995}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-15977

  • common-name:
    • 1,2-dioleoylglycerol
  • smiles:
    • ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o
  • inchi-key:
    • afshuzfnmvjnkx-llwmboqksa-n
  • molecular-weight:
    • 620.995

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality