Difference between revisions of "CPD-15977"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
(Created page with "Category:metabolite == Metabolite CPD-15977 == * common-name: ** 1,2-dioleoylglycerol * smiles: ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o * inchi-key: ** a...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-15977 == |
* common-name: | * common-name: | ||
− | ** | + | ** 1,2-dioleoylglycerol |
* smiles: | * smiles: | ||
− | ** | + | ** ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** afshuzfnmvjnkx-llwmboqksa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 620.995 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-15090]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=1,2-dioleoylglycerol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=afshuzfnmvjnkx-llwmboqksa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=620.995}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-15977
- common-name:
- 1,2-dioleoylglycerol
- smiles:
- ccccccccc=ccccccccc(=o)occ(co)oc(cccccccc=ccccccccc)=o
- inchi-key:
- afshuzfnmvjnkx-llwmboqksa-n
- molecular-weight:
- 620.995