Difference between revisions of "CPD-15977"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7206 == * common-name: ** 8'-apo-β-carotenal * smiles: ** cc(c=cc=c(c=cc1(c(cccc=1c)(c)c))c)=cc=cc=c(c=cc=c(c=o)c)c * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite CPD-181 == * common-name: ** 4-methylumbelliferyl acetate * smiles: ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) * inchi-key: ** hxvzgascdag...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-181 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 4-methylumbelliferyl acetate |
* smiles: | * smiles: | ||
| − | ** | + | ** cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** hxvzgascdagaps-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 218.209 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[3.1.1.56-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4-methylumbelliferyl acetate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hxvzgascdagaps-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=218.209}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite CPD-181
- common-name:
- 4-methylumbelliferyl acetate
- smiles:
- cc2(=cc(oc1(=c(c=cc(oc(=o)c)=c1)2))=o)
- inchi-key:
- hxvzgascdagaps-uhfffaoysa-n
- molecular-weight:
- 218.209
