Difference between revisions of "CPD-16016"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.4-RXN 1.3.7.4-RXN] == * direction: ** left-to-right * common-name: ** phytochromobilin:ferred...")
(Created page with "Category:metabolite == Metabolite INOSITOL-1-4-BISPHOSPHATE == * common-name: ** d-myo-inositol (1,4)-bisphosphate * smiles: ** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=1.3.7.4-RXN 1.3.7.4-RXN] ==
+
== Metabolite INOSITOL-1-4-BISPHOSPHATE ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** phytochromobilin:ferredoxin oxidoreductase
+
** d-myo-inositol (1,4)-bisphosphate
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.7.4 ec-1.3.7.4]
+
** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
== Reaction formula ==
+
* inchi-key:
* 1 [[BILIVERDINE]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Reduced-ferredoxins]][c] '''=>''' 1 [[3Z-PHYTOCHROMOBILIN]][c] '''+''' 2 [[Oxidized-ferredoxins]][c]
+
** pelzspzcxgtumr-rtphhqfdsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ04581]]
+
** 336.085
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[3.1.3.57-RXN]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[3.1.3.56-RXN]]
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[RXN-13334]]
== Pathway(s) ==
+
== Reaction(s) of unknown directionality ==
* [[PWY-7170]], phytochromobilin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7170 PWY-7170]
+
{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
** '''2''' reactions found over '''3''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
== Reconstruction information  ==
+
{{#set: molecular-weight=336.085}}
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16379 16379]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03678 R03678]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=phytochromobilin:ferredoxin oxidoreductase}}
 
{{#set: ec-number=ec-1.3.7.4}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation|orthology}}
 
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome|output_pantograph_arabidopsis_thaliana}}
 

Revision as of 20:34, 18 December 2020

Metabolite INOSITOL-1-4-BISPHOSPHATE

  • common-name:
    • d-myo-inositol (1,4)-bisphosphate
  • smiles:
    • c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
  • inchi-key:
    • pelzspzcxgtumr-rtphhqfdsa-j
  • molecular-weight:
    • 336.085

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality