Difference between revisions of "CPD-16016"

Revision as of 14:57, 5 January 2021

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite INOSITOL-1-4-BISPHOSPHATE ==
+== Metabolite THR ==
 * common-name:
-** d-myo-inositol (1,4)-bisphosphate
+** l-threonine
 * smiles:
-** c1(o)(c(o)c(op(=o)([o-])[o-])c(o)c(o)c(op([o-])([o-])=o)1)
+** cc(o)c([n+])c(=o)[o-]
 * inchi-key:
-** pelzspzcxgtumr-rtphhqfdsa-j
+** ayfvyjqapqtccc-gbxijsldsa-n
 * molecular-weight:
-** 336.085
+** 119.12
 == Reaction(s) known to consume the compound ==
-* [[3.1.3.57-RXN]]
+* [[RXN-14249]]
+* [[RXN-14569]]
+* [[RXN-15122]]
+* [[THREDEHYD-RXN]]
+* [[THREODEHYD-RXN]]
+* [[THREONINE--TRNA-LIGASE-RXN]]
+* [[THREONINE-ALDOLASE-RXN]]
+* [[biomass_rxn]]
 == Reaction(s) known to produce the compound ==
-* [[3.1.3.56-RXN]]
+* [[RXN-14569]]
-* [[RXN-13334]]
+* [[RXN-15122]]
+* [[RXN0-6980]]
+* [[THRESYN-RXN]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=d-myo-inositol (1,4)-bisphosphate}}
+{{#set: common-name=l-threonine}}
-{{#set: inchi-key=inchikey=pelzspzcxgtumr-rtphhqfdsa-j}}
+{{#set: inchi-key=inchikey=ayfvyjqapqtccc-gbxijsldsa-n}}
-{{#set: molecular-weight=336.085}}
+{{#set: molecular-weight=119.12}}