Difference between revisions of "CPD-16017"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CARBAMYUL-L-ASPARTATE == * common-name: ** n-carbamoyl-l-aspartate * smiles: ** c(=o)([o-])cc(nc(n)=o)c([o-])=o * inchi-key: ** hlkxyzvta...")
(Created page with "Category:metabolite == Metabolite CPD-16017 == * common-name: ** ergosteryl oleate * smiles: ** ccccccccc=ccccccccc(oc4(ccc1(c)(c(=cc=c2([ch]1ccc3(c)([ch](c(c=cc(c)c(c)c)c...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CARBAMYUL-L-ASPARTATE ==
+
== Metabolite CPD-16017 ==
 
* common-name:
 
* common-name:
** n-carbamoyl-l-aspartate
+
** ergosteryl oleate
 
* smiles:
 
* smiles:
** c(=o)([o-])cc(nc(n)=o)c([o-])=o
+
** ccccccccc=ccccccccc(oc4(ccc1(c)(c(=cc=c2([ch]1ccc3(c)([ch](c(c=cc(c)c(c)c)c)cc[ch]23)))c4)))=o
 
* inchi-key:
 
* inchi-key:
** hlkxyzvtanabhz-reohclbhsa-l
+
** vvznllxlokrqph-nzirwoiasa-n
 
* molecular-weight:
 
* molecular-weight:
** 174.113
+
** 661.105
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ASPCARBTRANS-RXN]]
+
* [[RXN-15135]]
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ASPCARBTRANS-RXN]]
 
* [[DIHYDROOROT-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-carbamoyl-l-aspartate}}
+
{{#set: common-name=ergosteryl oleate}}
{{#set: inchi-key=inchikey=hlkxyzvtanabhz-reohclbhsa-l}}
+
{{#set: inchi-key=inchikey=vvznllxlokrqph-nzirwoiasa-n}}
{{#set: molecular-weight=174.113}}
+
{{#set: molecular-weight=661.105}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-16017

  • common-name:
    • ergosteryl oleate
  • smiles:
    • ccccccccc=ccccccccc(oc4(ccc1(c)(c(=cc=c2([ch]1ccc3(c)([ch](c(c=cc(c)c(c)c)c)cc[ch]23)))c4)))=o
  • inchi-key:
    • vvznllxlokrqph-nzirwoiasa-n
  • molecular-weight:
    • 661.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality