Difference between revisions of "CPD-16017"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-Acylethanolamines == * common-name: ** an n-acylethanolamine == Reaction(s) known to consume the compound == == Reaction(s) known to pr...") |
(Created page with "Category:metabolite == Metabolite CPD-281 == * common-name: ** s-(2-methylpropanoyl)-dihydrolipoamide * smiles: ** cc(c(sc(ccccc(n)=o)ccs)=o)c * inchi-key: ** xzukurpvwdtx...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-281 == |
* common-name: | * common-name: | ||
| − | ** | + | ** s-(2-methylpropanoyl)-dihydrolipoamide |
| + | * smiles: | ||
| + | ** cc(c(sc(ccccc(n)=o)ccs)=o)c | ||
| + | * inchi-key: | ||
| + | ** xzukurpvwdtxge-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 277.439 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[DHRT_LPAREN_ibcoa_RPAREN_]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=s-(2-methylpropanoyl)-dihydrolipoamide}} |
| + | {{#set: inchi-key=inchikey=xzukurpvwdtxge-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=277.439}} | ||
Revision as of 13:07, 14 January 2021
Contents
Metabolite CPD-281
- common-name:
- s-(2-methylpropanoyl)-dihydrolipoamide
- smiles:
- cc(c(sc(ccccc(n)=o)ccs)=o)c
- inchi-key:
- xzukurpvwdtxge-uhfffaoysa-n
- molecular-weight:
- 277.439
