Difference between revisions of "CPD-16475"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAPOXNPHOSPHN-RXN GAPOXNPHOSPHN-RXN] == * direction: ** reversible * common-name: ** glyceraldehyde...") |
(Created page with "Category:metabolite == Metabolite CPD-16475 == * common-name: ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine * smiles: ** c...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-16475 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine |
− | + | * smiles: | |
− | + | ** cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3) | |
− | + | * inchi-key: | |
− | * | + | ** hbbozfuqjdyasd-qgtnpelvsa-n |
− | + | * molecular-weight: | |
− | + | ** 529.494 | |
− | + | == Reaction(s) known to consume the compound == | |
− | * | + | * [[RXN-15268]] |
− | + | == Reaction(s) known to produce the compound == | |
− | ** | + | * [[RXN-15268]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine}} | |
− | + | {{#set: inchi-key=inchikey=hbbozfuqjdyasd-qgtnpelvsa-n}} | |
− | + | {{#set: molecular-weight=529.494}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-16475
- common-name:
- β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine
- smiles:
- cc3(c(o)c(o)c(o)c(oc2(c(nc(c)=o)c(o)oc(co)c(oc1(oc(co)c(o)c(o)c(o)1))2))o3)
- inchi-key:
- hbbozfuqjdyasd-qgtnpelvsa-n
- molecular-weight:
- 529.494
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "β-d-galactosyl-(1→4)-[α-l-fucosyl-(1→3)]-n-acetyl-β-d-glucosamine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.