Difference between revisions of "CPD-16551"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14218 RXN-14218] == * direction: ** left-to-right == Reaction formula == * 1 DGDP[c] '''+''...") |
(Created page with "Category:metabolite == Metabolite CPD-16551 == * common-name: ** β-d-ribose 5-phosphate * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) * inchi-key: ** ktvpxoyakdp...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-16551 == |
− | * | + | * common-name: |
− | ** | + | ** β-d-ribose 5-phosphate |
− | + | * smiles: | |
− | * | + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) |
− | + | * inchi-key: | |
− | * | + | ** ktvpxoyakdprhy-txicztdvsa-l |
− | ** | + | * molecular-weight: |
− | ** | + | ** 228.095 |
− | == | + | == Reaction(s) known to consume the compound == |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
− | == | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=β-d-ribose 5-phosphate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}} |
− | + | {{#set: molecular-weight=228.095}} | |
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-16551
- common-name:
- β-d-ribose 5-phosphate
- smiles:
- c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1)
- inchi-key:
- ktvpxoyakdprhy-txicztdvsa-l
- molecular-weight:
- 228.095