|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9538 RXN-9538] == | + | == Metabolite CPD-16551 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (nadph, b-specific) | + | ** β-d-ribose 5-phosphate |
| − | ** fatty acid synthase
| + | * smiles: |
| − | ** myristoyl-[acp] reductase
| + | ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o)o1) |
| − | * ec-number: | + | * inchi-key: |
| − | ** [http://enzyme.expasy.org/EC/1.3.1.10 ec-1.3.1.10] | + | ** ktvpxoyakdprhy-txicztdvsa-l |
| − | ** [http://enzyme.expasy.org/EC/1.3.1.39 ec-1.3.1.39]
| + | * molecular-weight: |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.85 ec-2.3.1.85]
| + | ** 228.095 |
| − | ** [http://enzyme.expasy.org/EC/2.3.1.86 ec-2.3.1.86]
| + | == Reaction(s) known to consume the compound == |
| − | * synonymous:
| + | == Reaction(s) known to produce the compound == |
| − | ** trans tetradec-2-enoyl-[acp] reductase
| + | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] |
| − | == Reaction formula == | + | == Reaction(s) of unknown directionality == |
| − | * 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Tetradec-2-enoyl-ACPs]][c] '''=>''' 1 [[Myristoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
| + | {{#set: common-name=β-d-ribose 5-phosphate}} |
| − | == Gene(s) associated with this reaction ==
| + | {{#set: inchi-key=inchikey=ktvpxoyakdprhy-txicztdvsa-l}} |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | {{#set: molecular-weight=228.095}} |
| − | * Gene: [[SJ10624]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ04443]]
| |
| − | ** Category: [[annotation]] | |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ04769]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06616]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ17743]] | |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a | |
| − | * Gene: [[SJ19629]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ18059]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06617]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ00320]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ13014]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ00613]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ06944]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ11672]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | * Gene: [[SJ03883]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
| |
| − | * Gene: [[SJ15983]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) == | |
| − | * [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] | |
| − | ** '''31''' reactions found over '''31''' reactions in the full pathway
| |
| − | == Reconstruction information ==
| |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=fatty acid synthase|trans tetradec-2-enoyl-[acyl-carrier-protein] reductase (nadph, b-specific)|myristoyl-[acp] reductase}} | |
| − | {{#set: ec-number=ec-2.3.1.85|ec-1.3.1.10|ec-2.3.1.86|ec-1.3.1.39}} | |
| − | {{#set: synonymous=trans tetradec-2-enoyl-[acp] reductase}} | |
| − | {{#set: nb gene associated=15}}
| |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation}}
| |
| − | {{#set: reconstruction tool=pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=saccharina_japonica_genome}}
| |
