Difference between revisions of "CPD-166"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-14115 == * common-name: ** (s)-equol * smiles: ** c3(c(c1(cc2(=cc=c(c=c(oc1)2)o)))=cc=c(c=3)o) * inchi-key: ** adfcqwzhkcxpaj-gfccveg...") |
(Created page with "Category:metabolite == Metabolite CPD-166 == * common-name: ** a dolichyl β-d-glucosyl phosphate == Reaction(s) known to consume the compound == * RXN-5470 * RX...") |
||
| (2 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-166 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dolichyl β-d-glucosyl phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-5470]] |
| + | * [[RXN-5471]] | ||
| + | * [[RXN-5472]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.4.1.117-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dolichyl β-d-glucosyl phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-166
- common-name:
- a dolichyl β-d-glucosyl phosphate
