Difference between revisions of "CPD-16758"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...") |
(Created page with "Category:metabolite == Metabolite CPD-16758 == * common-name: ** 2/3-phospho-d-glycerate == Reaction(s) known to consume the compound == * RXN-15509 * RXN-15512 ==...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-16758 == |
* common-name: | * common-name: | ||
− | ** | + | ** 2/3-phospho-d-glycerate |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-15509]] |
− | + | * [[RXN-15512]] | |
− | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15509]] |
+ | * [[RXN-15512]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=2/3-phospho-d-glycerate}} |
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-16758
- common-name:
- 2/3-phospho-d-glycerate