Difference between revisions of "CPD-16758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=IVCDH IVCDH] == * direction: ** left-to-right * common-name: ** isovaleryl-coa dehydrogenase == Rea...")
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=IVCDH IVCDH] ==
+
== Metabolite L-HISTIDINOL-P ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** isovaleryl-coa dehydrogenase
+
** l-histidinol phosphate
== Reaction formula ==
+
* smiles:
* 1.0 [[FAD]][m] '''+''' 1.0 [[ISOVALERYL-COA]][m] '''=>''' 1.0 [[3-METHYL-CROTONYL-COA]][m] '''+''' 1.0 [[FADH2]][m]
+
** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
== Gene(s) associated with this reaction  ==
+
* inchi-key:
* Gene: [[SJ07241]]
+
** cwnderhthmwbsi-yfkpbyrvsa-m
** Category: [[orthology]]
+
* molecular-weight:
*** Source: [[output_pantograph_nannochloropsis_salina]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
** 220.144
== Pathway(s) ==
+
== Reaction(s) known to consume the compound ==
== Reconstruction information  ==
+
* [[HISTAMINOTRANS-RXN]]
* category: [[orthology]]; source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
+
* [[HISTIDPHOS-RXN]]
== External links  ==
+
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
{{#set: direction=left-to-right}}
+
== Reaction(s) known to produce the compound ==
{{#set: common-name=isovaleryl-coa dehydrogenase}}
+
* [[HISTAMINOTRANS-RXN]]
{{#set: nb gene associated=1}}
+
== Reaction(s) of unknown directionality ==
{{#set: nb pathway associated=0}}
+
{{#set: common-name=l-histidinol phosphate}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular-weight=220.144}}
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=output_pantograph_nannochloropsis_salina}}
 

Revision as of 20:35, 18 December 2020

Metabolite L-HISTIDINOL-P

  • common-name:
    • l-histidinol phosphate
  • smiles:
    • c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
  • inchi-key:
    • cwnderhthmwbsi-yfkpbyrvsa-m
  • molecular-weight:
    • 220.144

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality