Difference between revisions of "CPD-16758"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite L-HISTIDINOL-P == * common-name: ** l-histidinol phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+]) * inchi-key: ** cwnderhthmwb...")
(Created page with "Category:metabolite == Metabolite DNA-N == * common-name: ** dnan == Reaction(s) known to consume the compound == * 3.1.11.1-RXN * 3.1.11.2-RXN * DNA-DIRECTED-DN...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite L-HISTIDINOL-P ==
+
== Metabolite DNA-N ==
 
* common-name:
 
* common-name:
** l-histidinol phosphate
+
** dnan
* smiles:
 
** c1(nc=nc=1cc(cop([o-])(=o)[o-])[n+])
 
* inchi-key:
 
** cwnderhthmwbsi-yfkpbyrvsa-m
 
* molecular-weight:
 
** 220.144
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[3.1.11.1-RXN]]
* [[HISTIDPHOS-RXN]]
+
* [[3.1.11.2-RXN]]
* [[HISTIDPHOS-RXN[CCO-CYTOSOL]-L-HISTIDINOL-P/WATER//HISTIDINOL/Pi.49.]]
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[RXN0-4961]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[3.1.11.1-RXN]]
 +
* [[3.1.11.2-RXN]]
 +
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[DNA-LIGASE-ATP-RXN]]
 +
* [[DNA-LIGASE-NAD+-RXN]]
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
* [[RXN-15712]]
 +
* [[RXN-15713]]
 +
* [[RXN-17919]]
 +
* [[RXN-17923]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=l-histidinol phosphate}}
+
{{#set: common-name=dnan}}
{{#set: inchi-key=inchikey=cwnderhthmwbsi-yfkpbyrvsa-m}}
 
{{#set: molecular-weight=220.144}}
 

Revision as of 14:58, 5 January 2021