Difference between revisions of "CPD-16817"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * smiles: ** c(o)c2(oc(oc1(c(co)oc(o)c(o)c(o)1))c(o)c(=o)c(o)2) * inchi-key: ** hkkhtab...") |
(Created page with "Category:metabolite == Metabolite CPD-16817 == * common-name: ** indoxyl sulfate * smiles: ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) * inchi-key: ** bxffhsidqofmle-uhfffa...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-16817 == |
* common-name: | * common-name: | ||
| − | ** | + | ** indoxyl sulfate |
* smiles: | * smiles: | ||
| − | ** | + | ** c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2)) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** bxffhsidqofmle-uhfffaoysa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 212.2 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-15587]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15587]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indoxyl sulfate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=bxffhsidqofmle-uhfffaoysa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=212.2}} |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-16817
- common-name:
- indoxyl sulfate
- smiles:
- c2(c=cc1(=c(c(os([o-])(=o)=o)=cn1)c=2))
- inchi-key:
- bxffhsidqofmle-uhfffaoysa-m
- molecular-weight:
- 212.2
