Difference between revisions of "CPD-16817"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-6661 == * common-name: ** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate * smiles: ** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op...")
(Created page with "Category:metabolite == Metabolite CPD-6321 == * common-name: ** a [procollagen] trans 4-hyroxy-l-proline == Reaction(s) known to consume the compound == == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-6661 ==
+
== Metabolite CPD-6321 ==
 
* common-name:
 
* common-name:
** 1d-myo-inositol (1,2,3,4,6)-pentakisphosphate
+
** a [procollagen] trans 4-hyroxy-l-proline
* smiles:
 
** c1(o)(c(op([o-])(=o)[o-])c(op([o-])([o-])=o)c(op([o-])([o-])=o)c(op(=o)([o-])[o-])c(op(=o)([o-])[o-])1)
 
* inchi-key:
 
** ctpqaxvnygzuaj-qwbqgljisa-d
 
* molecular-weight:
 
** 569.977
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7186]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7186]]
+
* [[1.14.11.2-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1d-myo-inositol (1,2,3,4,6)-pentakisphosphate}}
+
{{#set: common-name=a [procollagen] trans 4-hyroxy-l-proline}}
{{#set: inchi-key=inchikey=ctpqaxvnygzuaj-qwbqgljisa-d}}
 
{{#set: molecular-weight=569.977}}
 

Revision as of 14:55, 5 January 2021

Metabolite CPD-6321

  • common-name:
    • a [procollagen] trans 4-hyroxy-l-proline

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [procollagen] trans 4-hyroxy-l-proline" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.