Difference between revisions of "CPD-16819"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-GULONOLACTONE-OXIDASE-RXN L-GULONOLACTONE-OXIDASE-RXN] == * direction: ** left-to-right * common-...")
 
(Created page with "Category:metabolite == Metabolite CPD-16819 == * common-name: ** 4-methylphenyl sulfate * smiles: ** cc1(c=cc(=cc=1)os(=o)(=o)[o-]) * inchi-key: ** wgnakzgusrvwrh-uhfffaoy...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=L-GULONOLACTONE-OXIDASE-RXN L-GULONOLACTONE-OXIDASE-RXN] ==
+
== Metabolite CPD-16819 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** l-gulonolactone oxidase
+
** 4-methylphenyl sulfate
−
** gulonolactone (l-) oxidase
+
* smiles:
−
* synonymous:
+
** cc1(c=cc(=cc=1)os(=o)(=o)[o-])
−
** l-gulono-γ-lactone: o2 oxidoreductase
+
* inchi-key:
−
** l-gulono-γ-lactone:oxidoreductase
+
** wgnakzgusrvwrh-uhfffaoysa-m
−
** glo
+
* molecular-weight:
−
== Reaction formula ==
+
** 187.19
−
* 1 [[L-GULONO-1-4-LACTONE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CPD-329]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c]
+
== Reaction(s) known to consume the compound ==
−
== Gene(s) associated with this reaction  ==
+
* [[RXN-15588]]
−
* Gene: [[SJ03311]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
* [[RXN-15588]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ03315]]
+
{{#set: common-name=4-methylphenyl sulfate}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=wgnakzgusrvwrh-uhfffaoysa-m}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: molecular-weight=187.19}}
−
== Pathway(s) ==
 
−
* [[PWY3DJ-35471]], L-ascorbate biosynthesis IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY3DJ-35471 PWY3DJ-35471]
 
−
** '''3''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=12355 12355]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03184 R03184]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P10867 P10867]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=gulonolactone (l-) oxidase|l-gulonolactone oxidase}}
 
−
{{#set: synonymous=l-gulono-γ-lactone: o2 oxidoreductase|l-gulono-γ-lactone:oxidoreductase|glo}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:17, 18 March 2021

Metabolite CPD-16819

  • common-name:
    • 4-methylphenyl sulfate
  • smiles:
    • cc1(c=cc(=cc=1)os(=o)(=o)[o-])
  • inchi-key:
    • wgnakzgusrvwrh-uhfffaoysa-m
  • molecular-weight:
    • 187.19

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-16819&oldid=139585"