Difference between revisions of "CPD-16953"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21096 == * transcription-direction: ** positive * right-end-position: ** 2495 * left-end-position: ** 551 * centisome-position: ** 0.27831233 =...") |
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...") |
||
| (8 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-16953 == |
| − | * | + | * common-name: |
| − | ** | + | ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin |
| − | + | * smiles: | |
| − | + | ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) | |
| − | + | * inchi-key: | |
| − | * | + | ** ghrbcdhnysufrn-iuyqgcfvsa-n |
| − | + | * molecular-weight: | |
| − | ** | + | ** 223.234 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | + | * [[RXN-15733]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}} | |
| − | ** | + | {{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}} |
| − | + | {{#set: molecular-weight=223.234}} | |
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-16953
- common-name:
- 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
- smiles:
- cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- ghrbcdhnysufrn-iuyqgcfvsa-n
- molecular-weight:
- 223.234
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
