Difference between revisions of "CPD-16953"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ09709 == * transcription-direction: ** negative * right-end-position: ** 286052 * left-end-position: ** 277237 * centisome-position: ** 34.11291...")
(Created page with "Category:metabolite == Metabolite CPD-16953 == * common-name: ** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin * smiles: ** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2)) *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ09709 ==
+
== Metabolite CPD-16953 ==
* transcription-direction:
+
* common-name:
** negative
+
** 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
* right-end-position:
+
* smiles:
** 286052
+
** cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
* left-end-position:
+
* inchi-key:
** 277237
+
** ghrbcdhnysufrn-iuyqgcfvsa-n
* centisome-position:
+
* molecular-weight:
** 34.11291   
+
** 223.234
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-15733]]
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
* [[PROTEIN-KINASE-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ghrbcdhnysufrn-iuyqgcfvsa-n}}
** Category: [[orthology]]
+
{{#set: molecular-weight=223.234}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[RNA-POLYMERASE-SUBUNIT-KINASE-RXN]]
 
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
* [[RXN-8443]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
* [[PWY-5381]]
 
** '''6''' reactions found over '''11''' reactions in the full pathway
 
{{#set: transcription-direction=negative}}
 
{{#set: right-end-position=286052}}
 
{{#set: left-end-position=277237}}
 
{{#set: centisome-position=34.11291    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=3}}
 
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-16953

  • common-name:
    • 2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin
  • smiles:
    • cc2(c(c(c)o)=nc1(c(=o)nc(n)=nc=1n2))
  • inchi-key:
    • ghrbcdhnysufrn-iuyqgcfvsa-n
  • molecular-weight:
    • 223.234

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "2-amino-6-[1-hydroxyethyl]-7-methyl-7,8-dihydropterin" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.