Difference between revisions of "CPD-16954"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=D-LACTALDEHYDE-DEHYDROGENASE-RXN D-LACTALDEHYDE-DEHYDROGENASE-RXN] == * direction: ** reversible *...") |
(Created page with "Category:metabolite == Metabolite CPD-16954 == * common-name: ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate * smiles: ** cc2(c(c(c)op(=o)([...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-16954 == |
− | * | + | * common-name: |
− | + | ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate | |
− | + | * smiles: | |
− | ** [ | + | ** cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2)) |
− | + | * inchi-key: | |
− | * | + | ** pjdxuyncnwfpcz-iuyqgcfvsa-k |
− | = | + | * molecular-weight: |
− | * | + | ** 380.17 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-15733]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate}} | |
− | + | {{#set: inchi-key=inchikey=pjdxuyncnwfpcz-iuyqgcfvsa-k}} | |
− | * | + | {{#set: molecular-weight=380.17}} |
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-16954
- common-name:
- [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate
- smiles:
- cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
- inchi-key:
- pjdxuyncnwfpcz-iuyqgcfvsa-k
- molecular-weight:
- 380.17
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.