Difference between revisions of "CPD-16954"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE == * common-name: ** 1-palmitoylglycerol 3-phosphate * smiles: ** cccccccccccccccc(=o)occ(o)cop(=o)([o-])...")
(Created page with "Category:metabolite == Metabolite CPD-16954 == * common-name: ** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate * smiles: ** cc2(c(c(c)op(=o)([...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 1-PALMITOYLGLYCEROL-3-PHOSPHATE ==
+
== Metabolite CPD-16954 ==
 
* common-name:
 
* common-name:
** 1-palmitoylglycerol 3-phosphate
+
** [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate
 
* smiles:
 
* smiles:
** cccccccccccccccc(=o)occ(o)cop(=o)([o-])[o-]
+
** cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
 
* inchi-key:
 
* inchi-key:
** yndykprnfwppfu-gosisdbhsa-l
+
** pjdxuyncnwfpcz-iuyqgcfvsa-k
 
* molecular-weight:
 
* molecular-weight:
** 408.471
+
** 380.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17008]]
 
* [[RXN-17010]]
 
* [[RXN-17012]]
 
* [[RXN-17014]]
 
* [[RXN-17023]]
 
* [[RXN-17024]]
 
* [[RXN0-6705]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17018]]
+
* [[RXN-15733]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-palmitoylglycerol 3-phosphate}}
+
{{#set: common-name=[1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate}}
{{#set: inchi-key=inchikey=yndykprnfwppfu-gosisdbhsa-l}}
+
{{#set: inchi-key=inchikey=pjdxuyncnwfpcz-iuyqgcfvsa-k}}
{{#set: molecular-weight=408.471}}
+
{{#set: molecular-weight=380.17}}

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-16954

  • common-name:
    • [1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate
  • smiles:
    • cc2(c(c(c)op(=o)([o-])op(=o)([o-])[o-])=nc1(c(=o)nc(n)=nc=1n2))
  • inchi-key:
    • pjdxuyncnwfpcz-iuyqgcfvsa-k
  • molecular-weight:
    • 380.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "1-(2-amino-7-methyl-4-oxo-7,8-dihydro-3h-pteridin-6-yl)]ethyl diphosphate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.