Difference between revisions of "CPD-170"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Charged-ASN-tRNAs == * common-name: ** an l-asparaginyl-[trnaasn] == Reaction(s) known to consume the compound == * RXN-12460 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-170 == * common-name: ** stachyose * smiles: ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2...") |
||
| (4 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-170 == |
* common-name: | * common-name: | ||
| − | ** | + | ** stachyose |
| + | * smiles: | ||
| + | ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4)) | ||
| + | * inchi-key: | ||
| + | ** uqziybxshagnoe-xnsrjbnmsa-n | ||
| + | * molecular-weight: | ||
| + | ** 666.583 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.4.1.67-RXN]] |
| + | * [[RXN-11501]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[2.4.1.67-RXN]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=stachyose}} |
| + | {{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}} | ||
| + | {{#set: molecular-weight=666.583}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-170
- common-name:
- stachyose
- smiles:
- c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4))
- inchi-key:
- uqziybxshagnoe-xnsrjbnmsa-n
- molecular-weight:
- 666.583
