|
|
| (9 intermediate revisions by 5 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ19255 == | + | == Metabolite CPD-170 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** negative | + | ** stachyose |
| − | * right-end-position: | + | * smiles: |
| − | ** 137387 | + | ** c(o)c1(c(o)c(o)c(o)c(o1)occ4(c(o)c(o)c(o)c(occ3(c(o)c(o)c(o)c(oc2(co)(c(o)c(o)c(co)o2))o3))o4)) |
| − | * left-end-position: | + | * inchi-key: |
| − | ** 116560 | + | ** uqziybxshagnoe-xnsrjbnmsa-n |
| − | * centisome-position: | + | * molecular-weight: |
| − | ** 50.876904 | + | ** 666.583 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[2.4.1.67-RXN]] |
| − | == Reaction(s) associated == | + | * [[RXN-11501]] |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| + | == Reaction(s) known to produce the compound == |
| − | * [[GPPSYN-RXN]] | + | * [[2.4.1.67-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| + | {{#set: common-name=stachyose}} |
| − | * [[RXN-11486]]
| + | {{#set: inchi-key=inchikey=uqziybxshagnoe-xnsrjbnmsa-n}} |
| − | ** Category: [[annotation]]
| + | {{#set: molecular-weight=666.583}} |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-9003]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN-9384]] | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a | |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[RXN0-5180]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | </div>
| |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6383]]
| |
| − | ** '''2''' reactions found over '''5''' reactions in the full pathway
| |
| − | * [[PWY-7410]]
| |
| − | ** '''1''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7102]]
| |
| − | ** '''3''' reactions found over '''6''' reactions in the full pathway
| |
| − | * [[PWY-6859]]
| |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7736]]
| |
| − | ** '''3''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5122]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7141]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-7659]]
| |
| − | ** '''1''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-7709]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5123]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY-7182]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-6520]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | * [[PWY-7235]]
| |
| − | ** '''3''' reactions found over '''n.a''' reactions in the full pathway
| |
| − | * [[PWY3O-19]]
| |
| − | ** '''4''' reactions found over '''8''' reactions in the full pathway
| |
| − | * [[PWY-5815]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY-5805]]
| |
| − | ** '''1''' reactions found over '''1''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=negative}} | |
| − | {{#set: right-end-position=137387}} | |
| − | {{#set: left-end-position=116560}}
| |
| − | {{#set: centisome-position=50.876904 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=6}}
| |
| − | {{#set: nb pathway associated=16}}
| |
