Difference between revisions of "CPD-17047"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Charged-MET-tRNAs == * common-name: ** an l-methionyl-[elongator trnamet] == Reaction(s) known to consume the compound == == Reaction(s)...")
(Created page with "Category:metabolite == Metabolite CPD-17047 == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Charged-MET-tRNAs ==
+
== Metabolite CPD-17047 ==
 
* common-name:
 
* common-name:
** an l-methionyl-[elongator trnamet]
+
** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
 +
* smiles:
 +
** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
 +
* inchi-key:
 +
** chbulttudaiwdp-hcihmxrssa-n
 +
* molecular-weight:
 +
** 586.634
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[METHIONINE--TRNA-LIGASE-RXN]]
+
* [[RXN-15681]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an l-methionyl-[elongator trnamet]}}
+
{{#set: common-name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}}
 +
{{#set: inchi-key=inchikey=chbulttudaiwdp-hcihmxrssa-n}}
 +
{{#set: molecular-weight=586.634}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17047

  • common-name:
    • 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
  • smiles:
    • c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
  • inchi-key:
    • chbulttudaiwdp-hcihmxrssa-n
  • molecular-weight:
    • 586.634

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality