Difference between revisions of "CPD-17047"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ21324 == * transcription-direction: ** positive * right-end-position: ** 451234 * left-end-position: ** 435126 * centisome-position: ** 72.463875...") |
(Created page with "Category:metabolite == Metabolite CPD-17047 == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))...") |
||
(8 intermediate revisions by 4 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17047 == |
− | * | + | * common-name: |
− | ** | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine |
− | + | * smiles: | |
− | + | ** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+] | |
− | + | * inchi-key: | |
− | + | ** chbulttudaiwdp-hcihmxrssa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 586.634 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-15681]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}} | |
− | + | {{#set: inchi-key=inchikey=chbulttudaiwdp-hcihmxrssa-n}} | |
− | + | {{#set: molecular-weight=586.634}} | |
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-17047
- common-name:
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
- inchi-key:
- chbulttudaiwdp-hcihmxrssa-n
- molecular-weight:
- 586.634