Difference between revisions of "CPD-17047"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Octanoylated-Gcv-H == * common-name: ** a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine == Reaction(s) known to consume the c...") |
(Created page with "Category:metabolite == Metabolite CPD-17047 == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-17047 == |
* common-name: | * common-name: | ||
− | ** | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine |
+ | * smiles: | ||
+ | ** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+] | ||
+ | * inchi-key: | ||
+ | ** chbulttudaiwdp-hcihmxrssa-n | ||
+ | * molecular-weight: | ||
+ | ** 586.634 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15681]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}} |
+ | {{#set: inchi-key=inchikey=chbulttudaiwdp-hcihmxrssa-n}} | ||
+ | {{#set: molecular-weight=586.634}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-17047
- common-name:
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
- inchi-key:
- chbulttudaiwdp-hcihmxrssa-n
- molecular-weight:
- 586.634