Difference between revisions of "CPD-17047"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ05318 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 3.6.4.4-RXN ** Categor...") |
(Created page with "Category:metabolite == Metabolite CPD-17047 == * common-name: ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine * smiles: ** c(sc2(cc1(=cc=cc=c1))...") |
||
| (9 intermediate revisions by 5 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-17047 == |
| − | == | + | * common-name: |
| − | + | ** 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine | |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+] |
| − | + | * inchi-key: | |
| − | + | ** chbulttudaiwdp-hcihmxrssa-n | |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 586.634 |
| + | == Reaction(s) known to consume the compound == | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-15681]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine}} | ||
| + | {{#set: inchi-key=inchikey=chbulttudaiwdp-hcihmxrssa-n}} | ||
| + | {{#set: molecular-weight=586.634}} | ||
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-17047
- common-name:
- 3-benzyl-3,6 -bis(cysteinylglycine)- 6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(sc2(cc1(=cc=cc=c1))(nc(=o)c(scc(c(ncc([o-])=o)=o)[n+])(co)nc(=o)2))c(c(ncc([o-])=o)=o)[n+]
- inchi-key:
- chbulttudaiwdp-hcihmxrssa-n
- molecular-weight:
- 586.634
