Difference between revisions of "CPD-17047"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11409 == * common-name: ** tetraiodothyroacetate ether glucuronide * smiles: ** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c...")
(Created page with "Category:metabolite == Metabolite Octanoylated-Gcv-H == * common-name: ** a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine == Reaction(s) known to consume the c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11409 ==
+
== Metabolite Octanoylated-Gcv-H ==
 
* common-name:
 
* common-name:
** tetraiodothyroacetate ether glucuronide
+
** a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine
* smiles:
 
** c(=o)([o-])cc1(c=c(i)c(=c(i)c=1)oc3(=cc(i)=c(oc2(oc(c([o-])=o)c(o)c(o)c(o)2))c(i)=c3))
 
* inchi-key:
 
** gyorpzqlvmnogy-rupwjetcsa-l
 
* molecular-weight:
 
** 921.943
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-14950]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10616]]
+
* [[RXN-13037]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetraiodothyroacetate ether glucuronide}}
+
{{#set: common-name=a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine}}
{{#set: inchi-key=inchikey=gyorpzqlvmnogy-rupwjetcsa-l}}
 
{{#set: molecular-weight=921.943}}
 

Revision as of 14:54, 5 January 2021

Metabolite Octanoylated-Gcv-H

  • common-name:
    • a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycine-cleavage complex h protein] n6-octanoyl-l-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.