Difference between revisions of "CPD-17049"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17245 == * transcription-direction: ** positive * right-end-position: ** 595632 * left-end-position: ** 570503 * centisome-position: ** 84.22872...") |
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))n...") |
||
(8 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-17049 == |
− | * | + | * common-name: |
− | ** | + | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine |
− | + | * smiles: | |
− | + | ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2) | |
− | + | * inchi-key: | |
− | + | ** vzgsjjjqzptkgr-vxgbxaggsa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 298.374 |
− | = | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-15684]] | |
− | == | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}} | |
− | ** | + | {{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}} |
− | + | {{#set: molecular-weight=298.374}} | |
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17049
- common-name:
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
- inchi-key:
- vzgsjjjqzptkgr-vxgbxaggsa-n
- molecular-weight:
- 298.374