Difference between revisions of "CPD-17049"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DL-12-Propanediol == * common-name: ** propane-1,2-diol == Reaction(s) known to consume the compound == * RXN-17622 == Reaction(s) kn...") |
(Created page with "Category:metabolite == Metabolite CPD-17049 == * common-name: ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine * smiles: ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))n...") |
||
| (5 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-17049 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine |
| + | * smiles: | ||
| + | ** c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2) | ||
| + | * inchi-key: | ||
| + | ** vzgsjjjqzptkgr-vxgbxaggsa-n | ||
| + | * molecular-weight: | ||
| + | ** 298.374 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-15684]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}} |
| + | {{#set: inchi-key=inchikey=vzgsjjjqzptkgr-vxgbxaggsa-n}} | ||
| + | {{#set: molecular-weight=298.374}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-17049
- common-name:
- 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
- smiles:
- c(o)c2(s)(nc(=o)c(s)(cc1(=cc=cc=c1))nc(=o)2)
- inchi-key:
- vzgsjjjqzptkgr-vxgbxaggsa-n
- molecular-weight:
- 298.374
