Difference between revisions of "CPD-17050"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite BETA-D-FRUCTOSE == * common-name: ** β-d-fructofuranose * smiles: ** c(o)c1(oc(o)(co)c(c1o)o) * inchi-key: ** rfsuneuaizkajo-arqdhwq...") |
(Created page with "Category:metabolite == Metabolite CPDQT-40 == * common-name: ** 3-[(7'-methylthio)heptyl]malate * smiles: ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] * inchi-key: ** sxljfgxgvbw...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPDQT-40 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-[(7'-methylthio)heptyl]malate |
* smiles: | * smiles: | ||
| − | ** c(o) | + | ** cscccccccc(c(o)c(=o)[o-])c(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** sxljfgxgvbwoob-uhfffaoysa-l |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 276.347 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-18200]] |
| + | * [[RXNQT-4178]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-18200]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-[(7'-methylthio)heptyl]malate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=sxljfgxgvbwoob-uhfffaoysa-l}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=276.347}} |
Revision as of 08:28, 15 March 2021
Contents
Metabolite CPDQT-40
- common-name:
- 3-[(7'-methylthio)heptyl]malate
- smiles:
- cscccccccc(c(o)c(=o)[o-])c(=o)[o-]
- inchi-key:
- sxljfgxgvbwoob-uhfffaoysa-l
- molecular-weight:
- 276.347
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "3-[(7'-methylthio)heptyl]malate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
