Difference between revisions of "CPD-17070"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...")
(Created page with "Category:metabolite == Metabolite CPD-17070 == * common-name: ** fe-coproporphyrin iii * smiles: ** cc1(=c8(c=c4(c(c)=c(ccc([o-])=o)c5(c=c3(c(ccc([o-])=o)=c(c)c2(=cc7(c(cc...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15836 ==
+
== Metabolite CPD-17070 ==
 
* common-name:
 
* common-name:
** α-tocotrienol
+
** fe-coproporphyrin iii
 
* smiles:
 
* smiles:
** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
+
** cc1(=c8(c=c4(c(c)=c(ccc([o-])=o)c5(c=c3(c(ccc([o-])=o)=c(c)c2(=cc7(c(ccc(=o)[o-])=c(c)c6(=cc(=c(ccc([o-])=o)1)n([fe--](n23)([n+]4=5)[n+]6=7)8))))))))
 
* inchi-key:
 
* inchi-key:
** rzfhlolgzpdchj-xzxlulotsa-n
+
** sxdinbxhohhtmy-rggahwmasa-h
 
* molecular-weight:
 
* molecular-weight:
** 424.665
+
** 704.518
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14918]]
+
* [[RXN-17518]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-tocotrienol}}
+
{{#set: common-name=fe-coproporphyrin iii}}
{{#set: inchi-key=inchikey=rzfhlolgzpdchj-xzxlulotsa-n}}
+
{{#set: inchi-key=inchikey=sxdinbxhohhtmy-rggahwmasa-h}}
{{#set: molecular-weight=424.665}}
+
{{#set: molecular-weight=704.518}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-17070

  • common-name:
    • fe-coproporphyrin iii
  • smiles:
    • cc1(=c8(c=c4(c(c)=c(ccc([o-])=o)c5(c=c3(c(ccc([o-])=o)=c(c)c2(=cc7(c(ccc(=o)[o-])=c(c)c6(=cc(=c(ccc([o-])=o)1)n([fe--](n23)([n+]4=5)[n+]6=7)8))))))))
  • inchi-key:
    • sxdinbxhohhtmy-rggahwmasa-h
  • molecular-weight:
    • 704.518

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality