Difference between revisions of "CPD-171"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-10420 == * common-name: ** 4-sulfomuconolactone * smiles: ** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1) * inchi-key: ** weeoykxhmipyqx...") |
(Created page with "Category:metabolite == Metabolite CPD-171 == * common-name: ** a dolichyl β-d-mannosyl phosphate == Reaction(s) known to consume the compound == * 2.4.1.109-RXN *...") |
||
| (3 intermediate revisions by 2 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-171 == |
* common-name: | * common-name: | ||
| − | ** | + | ** a dolichyl β-d-mannosyl phosphate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[2.4.1.109-RXN]] |
| + | * [[RXN-5466]] | ||
| + | * [[RXN-5467]] | ||
| + | * [[RXN-5468]] | ||
| + | * [[RXN-5469]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.83-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a dolichyl β-d-mannosyl phosphate}} |
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-171
- common-name:
- a dolichyl β-d-mannosyl phosphate
