Difference between revisions of "CPD-171"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9699 == * common-name: ** hypoglycin a * smiles: ** c=c1(c(cc([n+])c([o-])=o)c1) * inchi-key: ** oojzcxfxpzgubj-uhfffaoysa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite N-4-aminobutylidene-enzyme-lysine == * common-name: ** a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine == Reaction(s) known to co...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-4-aminobutylidene-enzyme-lysine == |
* common-name: | * common-name: | ||
| − | ** | + | ** a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-13416]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-13415]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine}} |
| − | |||
| − | |||
Revision as of 15:26, 5 January 2021
Contents
Metabolite N-4-aminobutylidene-enzyme-lysine
- common-name:
- a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [deoxyhypusine synthase]-n-(4-aminobutylidene)-lysine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
