Difference between revisions of "CPD-17262"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12583 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite CPD-12481 == * common-name: ** 7-methylurate * smiles: ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) * inchi-key: ** yhnnpkufpwltop-uhfffaoysa-n * m...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12481 == |
− | + | * common-name: | |
− | * | + | ** 7-methylurate |
− | == | + | * smiles: |
− | * | + | ** cn1(c(=o)nc2(=c1c(=o)nc(=o)n2)) |
− | + | * inchi-key: | |
− | ** | + | ** yhnnpkufpwltop-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | + | ** 182.138 | |
− | ** | + | == Reaction(s) known to consume the compound == |
− | == | + | == Reaction(s) known to produce the compound == |
− | * [[ | + | * [[RXN-11521]] |
− | + | == Reaction(s) of unknown directionality == | |
− | {{#set: | + | {{#set: common-name=7-methylurate}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=yhnnpkufpwltop-uhfffaoysa-n}} |
− | {{#set: | + | {{#set: molecular-weight=182.138}} |
Revision as of 20:34, 18 December 2020
Contents
Metabolite CPD-12481
- common-name:
- 7-methylurate
- smiles:
- cn1(c(=o)nc2(=c1c(=o)nc(=o)n2))
- inchi-key:
- yhnnpkufpwltop-uhfffaoysa-n
- molecular-weight:
- 182.138