Difference between revisions of "CPD-17263"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ16976 == * transcription-direction: ** positive * right-end-position: ** 74608 * left-end-position: ** 60774 * centisome-position: ** 22.078121...")
(Created page with "Category:metabolite == Metabolite CPD-17263 == * common-name: ** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)scc...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ16976 ==
+
== Metabolite CPD-17263 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 74608
+
** ccc=ccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 60774
+
** pcgphlmaazkqfq-fpxdaddusa-j
−
* centisome-position:
+
* molecular-weight:
−
** 22.078121   
+
** 1065.958
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-16021]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[GLYCINE--TRNA-LIGASE-RXN]]
+
* [[RXN-16020]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=(8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa}}
−
** Category: [[orthology]]
+
{{#set: inchi-key=inchikey=pcgphlmaazkqfq-fpxdaddusa-j}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: molecular-weight=1065.958}}
−
== Pathway(s) associated ==
 
−
* [[TRNA-CHARGING-PWY]]
 
−
** '''21''' reactions found over '''21''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=74608}}
 
−
{{#set: left-end-position=60774}}
 
−
{{#set: centisome-position=22.078121    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17263

  • common-name:
    • (8z,11z,14z,17z)-3-hydroxy-icosa-8,11,14,17-tetraenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc(o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • pcgphlmaazkqfq-fpxdaddusa-j
  • molecular-weight:
    • 1065.958

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17263&oldid=137084"