Difference between revisions of "CPD-17264"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ02434 == * transcription-direction: ** negative * right-end-position: ** 99768 * left-end-position: ** 83548 * centisome-position: ** 15.419825...")
(Created page with "Category:metabolite == Metabolite CPD-17264 == * common-name: ** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)c...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ02434 ==
+
== Metabolite CPD-17264 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
−
* right-end-position:
+
* smiles:
−
** 99768
+
** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
−
* left-end-position:
+
* inchi-key:
−
** 83548
+
** ptromslvpfeiqj-qpyoymcksa-j
−
* centisome-position:
+
* molecular-weight:
−
** 15.419825   
+
** 1047.943
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
−
== Reaction(s) associated ==
+
* [[RXN-16021]]
−
* [[6PFRUCTPHOS-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=1047.943}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[PFK_]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-1861]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-5484]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-1042]]
 
−
** '''9''' reactions found over '''10''' reactions in the full pathway
 
−
* [[GLYCOLYSIS]]
 
−
** '''11''' reactions found over '''12''' reactions in the full pathway
 
−
* [[PWY-7385]]
 
−
** '''7''' reactions found over '''9''' reactions in the full pathway
 
−
* [[ANAGLYCOLYSIS-PWY]]
 
−
** '''10''' reactions found over '''11''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=99768}}
 
−
{{#set: left-end-position=83548}}
 
−
{{#set: centisome-position=15.419825    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=2}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17264

  • common-name:
    • (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ptromslvpfeiqj-qpyoymcksa-j
  • molecular-weight:
    • 1047.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-17264&oldid=137318"