Difference between revisions of "CPD-17264"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-309 == * common-name: ** d-octopine * smiles: ** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+] * inchi-key: ** imxsccduafeioe-ritpcoansa...")
(Created page with "Category:metabolite == Metabolite CPD-17264 == * common-name: ** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)c...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-309 ==
+
== Metabolite CPD-17264 ==
 
* common-name:
 
* common-name:
** d-octopine
+
** (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
 
* smiles:
 
* smiles:
** cc(c([o-])=o)[n+]c(c([o-])=o)cccnc(n)=[n+]
+
** ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** imxsccduafeioe-ritpcoansa-n
+
** ptromslvpfeiqj-qpyoymcksa-j
 
* molecular-weight:
 
* molecular-weight:
** 246.266
+
** 1047.943
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[D-OCTOPINE-DEHYDROGENASE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.5.1.11-RXN]]
+
* [[RXN-16021]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-octopine}}
+
{{#set: common-name=(2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa}}
{{#set: inchi-key=inchikey=imxsccduafeioe-ritpcoansa-n}}
+
{{#set: inchi-key=inchikey=ptromslvpfeiqj-qpyoymcksa-j}}
{{#set: molecular-weight=246.266}}
+
{{#set: molecular-weight=1047.943}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-17264

  • common-name:
    • (2e,8z,11z,14z,17z)-icosa-2,8,11,14,17-pentaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=cccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • ptromslvpfeiqj-qpyoymcksa-j
  • molecular-weight:
    • 1047.943

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality